Rovshen Rovshen

24-07-2019
Physics

contestada

4. A 15 V battery is connected to three capacitors in series. The capacitors have the following
capacitances: 4.54F, 12uF and 32uF. Find the voltage across the 32uF capacitor.

Respuesta :

marykatefitzsimons marykatefitzsimons

24-07-2019

Vp = Vs 14.o V battery 3.96 ûF

Answer Link

Otras preguntas

Shake something to and fro and you're measuring its what? lift it against gravity and you're measuring its what?

1 $0.5 2 $1.5 3 $2.5 4 $3.5 the project has a simple payback period of exactly three years. the project's cost of capital is 14 percent. what is the project's i

The agreements that allow out-of-state licensees to receive commissions from arizona licensees are established between which two parties?

Which skeletal structure corresponds to the condensed structure ch2(oh)ch2chchco2ch(ch3)2?

Identify at least five skills you have obtained through your general education courses that will make you successful at this job.

What does 5.2E−7 represent in a calculator? −5.20000000 −52,000,000 0.000000052 0.00000052

Why would it be problematic if the esophagus was lined with simple squamous epithelium?

PLEASE HELP FAST!!! Will give brainliest!! Directions: Using the data from the table above, draw the potential diagram for each reaction.

Introduction for physical science Please make the introduction longer

What are the ethical and legal considerations between a clinical supervisor and counseling graduate student?