kellerpaula kellerpaula

22-03-2020
Mathematics

contestada

Trigonometry
Angle Sum and Difference, Double Angle and Half Angle Formulas
Find the exact value of:
Sin 22* cos 38* + Cos 22* sin 38*

Respuesta :

amna04352 amna04352

22-03-2020

Answer:

sqrt(3)/2

Step-by-step explanation:

sinAcosB+cosAsinB = sin(A+B)

sin(22)cos(38)+cos(22)sin(38)

= sin(22+38) = sin(60)

= sqrt(3)/2

Answer Link

Otras preguntas

0.7 x 0.4=what is the answer and how did u get it

The inverse of p q is:

You have 20 apples in a basket. 20 children come to you and each one of them ask for an apple. You want to give all the apples to each one of them, but still ke

What are the characteristic distinguishes a ballad from other types of narrative poems?

The slow formation of clays and thin soils in the desert is due to _ _ _ __. a. mechanical weathering b. rainless winters c. decaying plants d. chemical wea

Which statement best describes the effects of drought desertification and erosion on the people who live in the Sahel on the edge of the Sahara desert

A critical period? A.begins and ends abruptly B.begins and ends gradually C.is unaffected by stimuli D.is unlikely to impact development

What is a dynamic equilibrium?

How could you use a number line to show that -4 + 3 and -3 + (-4)

For the element barium which wavelength of light is produced by the largest energy drop of an electron.