madisonp031 madisonp031

22-12-2020
Chemistry

contestada

1. Why does light have different effects on various materials?

Respuesta :

Daddywarbucks Daddywarbucks

22-12-2020

Light basically evaporates pigments such as colored paper. Exposed pigment fading is kind of like getting colored paper wet. It will fade and bleed.

Answer Link

princeofnewark princeofnewark

22-12-2020

Answer:

this kenny why u cheating on brainly?

Explanation:

Answer Link

Otras preguntas

when an electron in excited energy level drops to a lower energy level a photon is emitted, if the electron is dropping to n=1 which transition will emit the lo

a leader in a rigid, bureaucratic culture is more likely to be inspirational, influential, considerate, and intellectually stimulating than a leader in a flexib

opportunity cost requires some level of what?

in a certain country, 40 roads lead out of each city. when all roads are open, it is possible to travel from any city to any other. each road leads from one cit

When did boeing employees first see lockheed martin’s proposed bid for the project?.

CS 4402 Comparative Programming Languages Study; 9 studiers today; 5.0 (1 review)

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

Assume that the working ideal gas is one mole of the molecule H2, at a temperature such that the translational and rotational degrees of freedom are active. V1

The map above indicates that (A) Mali was a major source and hub of the gold trade (B) slavery existed in the western Sudan (C) Europeans had begun to make inro

One manager has told Hillary that it is part of her job to help answer the telephone, but another manager has told her to leave that task to the receptionist. H