annabranscum89 annabranscum89

25-10-2021
Mathematics

contestada

A 16 ounce box of a certain cereal cost $2.24 what is the cost per ounce of the cereal

Respuesta :

dragonace62love dragonace62love

25-10-2021

Answer:

$0.14 per ounce

Step-by-step explanation:

Divide $2.24 by 16 and theres your answer

Answer Link

Otras preguntas

Help me pls pls pls pls

Part 1 of 1 -Question 2 of 502 PointsSolve the equation for x. x/3 -1 = -2Copyright 2010-2020 edtell, LLC. All rights reserved. Portions of this software are co

Amanda is doing a report for her Earth Science class about the four seasons. Which of the following would be an effective scientific model to incorporate in her

A 700700700-Newton rightward net force is being applied to a 101010-kg object. What is the magnitude of the rightward acceleration on the object (in \text{ m}/\

What is the slope of the line shown below? (-2,3) (-4,-9)

Suppose you and your three friends have two dice each. When everyone rolls, what are the chances that there is at least one 6?

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

How could the ocean be used as a metaphor for medicine?

Find the length of the arc intercepted by central angle 0 = 250° in a circle with radius r = 13.9in. Round your answer to one decimal place.

The monomer of poly(vinyl chloride) has the formula C2H3Cl. If there are 1,565 repeat units in a single chain of the polymer, what is the molecular mass (in amu