lilahgodess2 lilahgodess2

22-03-2022
History

contestada

Under the 1st
Amendment, who is
NOT allowed to tell you
what to feel or think?
B. parents
A. government
D. education
C. religion

Respuesta :

liamdoug05 liamdoug05

22-03-2022

Answer:

I would say the government is not allowed to tell you what to feel or think

Explanation:

Answer Link

Otras preguntas

An Australian emu is running due north in a straight line at a speed of 13.0 m/s and slows down to a speed of 10.5 m/s in 4.20 s. (a) What is the magnitude and

What does the term, nuclear waste (from a nuclear facility), refer to? a) material that still contains radioactive particles and atoms b) unused chemical energy

How did the Student Nonviolent Coordinating Committee (SNCC) and Fannie Lou Hamer affect the civil rights movement?

Can someone please help me out with this question??

Which are important to consider when identifying the purpose of a speech? Check all that apply. cultural context expert opinion central ideas language audience

Complete the following dialogue with the correct word below:

For Bill's birthday his mom is bringing donuts to school. She has a coupon to get 2 dozen donuts for $8.00. How much would just one dozen donuts cost at this pr

Classify each of these reactions. Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g)Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g) acid–base neutralization precipitation redox none of the above 2NaCl(

If $190 is invested at an interest rate of 11% per year and is compounded continuously, how much will the investment be worth in 4 years? Use the continuous com

solve x^2=12x-15 by completing the square. which is the solution set of the equation?